About magnesium;2,2-dimethoxyethanol;hydride
magnesium;2,2-dimethoxyethanol;hydride (PubChem CID 174500323) has the molecular formula C4H12MgO3
and a molecular weight of 132.44 g/mol. Its IUPAC name is magnesium;2,2-dimethoxyethanol;hydride.
Molecular Properties
| Compound Name | magnesium;2,2-dimethoxyethanol;hydride |
| PubChem CID | 174500323 |
| Molecular Formula | C4H12MgO3 |
| Molecular Weight | 132.44 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | magnesium;2,2-dimethoxyethanol;hydride |
| SMILES | COC(CO)OC.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C4H10O3.Mg.2H/c1-6-4(3-5)7-2;;;/h4-5H,3H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | PTVYGLBTSMSNGK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2,2-dimethoxyethanol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2,2-dimethoxyethanol;hydride?
The IUPAC name of magnesium;2,2-dimethoxyethanol;hydride (CID 174500323) is magnesium;2,2-dimethoxyethanol;hydride.
What is the SMILES notation for magnesium;2,2-dimethoxyethanol;hydride?
The canonical SMILES for magnesium;2,2-dimethoxyethanol;hydride is COC(CO)OC.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;2,2-dimethoxyethanol;hydride?
The InChIKey is PTVYGLBTSMSNGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3.Mg.2H/c1-6-4(3-5)7-2;;;/h4-5H,3H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;2,2-dimethoxyethanol;hydride?
magnesium;2,2-dimethoxyethanol;hydride has a molecular weight of 132.44 g/mol, XLogP of -0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2,2-dimethoxyethanol;hydride is sourced from PubChem (CID 174500323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).