C4H12MgO3 — CID 174500323
magnesium;2,2-dimethoxyethanol;hydride (PubChem CID 174500323) has the molecular formula C4H12MgO3 and a molecular weight of 132.44 g/mol. Its IUPAC name is magnesium;2,2-dimethoxyethanol;hydride.
| Compound Name | magnesium;2,2-dimethoxyethanol;hydride |
|---|---|
| PubChem CID | 174500323 |
| Molecular Formula | C4H12MgO3 |
| Molecular Weight | 132.44 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | magnesium;2,2-dimethoxyethanol;hydride |
| SMILES | COC(CO)OC.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C4H10O3.Mg.2H/c1-6-4(3-5)7-2;;;/h4-5H,3H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | PTVYGLBTSMSNGK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.44 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|