C5H12O4 — CID 87270153
2-(hydroxymethyl)butane-1,1,4-triol (PubChem CID 87270153) has the molecular formula C5H12O4 and a molecular weight of 136.15 g/mol. Its IUPAC name is 2-(hydroxymethyl)butane-1,1,4-triol.
| Compound Name | 2-(hydroxymethyl)butane-1,1,4-triol |
|---|---|
| PubChem CID | 87270153 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 2-(hydroxymethyl)butane-1,1,4-triol |
| SMILES | OCCC(CO)C(O)O |
| InChI | InChI=1S/C5H12O4/c6-2-1-4(3-7)5(8)9/h4-9H,1-3H2 |
| InChIKey | FUTLMMOLPRAUOJ-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|