C8H14O4 — CID 57239510
5-(hydroxymethyl)hept-2-yne-1,4,7-triol (PubChem CID 57239510) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 5-(hydroxymethyl)hept-2-yne-1,4,7-triol.
| Compound Name | 5-(hydroxymethyl)hept-2-yne-1,4,7-triol |
|---|---|
| PubChem CID | 57239510 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 5-(hydroxymethyl)hept-2-yne-1,4,7-triol |
| SMILES | OCC#CC(O)C(CO)CCO |
| InChI | InChI=1S/C8H14O4/c9-4-1-2-8(12)7(6-11)3-5-10/h7-12H,3-6H2 |
| InChIKey | LAHWSKDWJVGIJK-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|