About (4S)-hex-2-yne-1,4-diol
(4S)-hex-2-yne-1,4-diol (PubChem CID 102369829) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is (4S)-hex-2-yne-1,4-diol.
Molecular Properties
| Compound Name | (4S)-hex-2-yne-1,4-diol |
| PubChem CID | 102369829 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | (4S)-hex-2-yne-1,4-diol |
| SMILES | CC[C@H](O)C#CCO |
| InChI | InChI=1S/C6H10O2/c1-2-6(8)4-3-5-7/h6-8H,2,5H2,1H3/t6-/m0/s1 |
| InChIKey | SBFXIKAUMNVVCT-LURJTMIESA-N |
| XLogP | -0.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-hex-2-yne-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-hex-2-yne-1,4-diol?
The IUPAC name of (4S)-hex-2-yne-1,4-diol (CID 102369829) is (4S)-hex-2-yne-1,4-diol.
What is the SMILES notation for (4S)-hex-2-yne-1,4-diol?
The canonical SMILES for (4S)-hex-2-yne-1,4-diol is CC[C@H](O)C#CCO.
What is the InChIKey of (4S)-hex-2-yne-1,4-diol?
The InChIKey is SBFXIKAUMNVVCT-LURJTMIESA-N. The full InChI is InChI=1S/C6H10O2/c1-2-6(8)4-3-5-7/h6-8H,2,5H2,1H3/t6-/m0/s1.
What are the key properties of (4S)-hex-2-yne-1,4-diol?
(4S)-hex-2-yne-1,4-diol has a molecular weight of 114.14 g/mol, XLogP of -0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-hex-2-yne-1,4-diol is sourced from PubChem (CID 102369829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).