About dec-4-yne-3,7-diol
dec-4-yne-3,7-diol (PubChem CID 123581692) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is dec-4-yne-3,7-diol.
Molecular Properties
| Compound Name | dec-4-yne-3,7-diol |
| PubChem CID | 123581692 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | dec-4-yne-3,7-diol |
| SMILES | CCCC(O)CC#CC(O)CC |
| InChI | InChI=1S/C10H18O2/c1-3-6-10(12)8-5-7-9(11)4-2/h9-12H,3-4,6,8H2,1-2H3 |
| InChIKey | WLVWSKWZYHYBAB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-4-yne-3,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-4-yne-3,7-diol?
The IUPAC name of dec-4-yne-3,7-diol (CID 123581692) is dec-4-yne-3,7-diol.
What is the SMILES notation for dec-4-yne-3,7-diol?
The canonical SMILES for dec-4-yne-3,7-diol is CCCC(O)CC#CC(O)CC.
What is the InChIKey of dec-4-yne-3,7-diol?
The InChIKey is WLVWSKWZYHYBAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-6-10(12)8-5-7-9(11)4-2/h9-12H,3-4,6,8H2,1-2H3.
What are the key properties of dec-4-yne-3,7-diol?
dec-4-yne-3,7-diol has a molecular weight of 170.25 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dec-4-yne-3,7-diol is sourced from PubChem (CID 123581692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).