C7H10O7S — CID 142708103
2,5-dihydroxypent-3-ynylsulfonyl ethaneperoxoate (PubChem CID 142708103) has the molecular formula C7H10O7S and a molecular weight of 238.22 g/mol. Its IUPAC name is 2,5-dihydroxypent-3-ynylsulfonyl ethaneperoxoate.
| Compound Name | 2,5-dihydroxypent-3-ynylsulfonyl ethaneperoxoate |
|---|---|
| PubChem CID | 142708103 |
| Molecular Formula | C7H10O7S |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 2,5-dihydroxypent-3-ynylsulfonyl ethaneperoxoate |
| SMILES | CC(=O)OOS(=O)(=O)CC(O)C#CCO |
| InChI | InChI=1S/C7H10O7S/c1-6(9)13-14-15(11,12)5-7(10)3-2-4-8/h7-8,10H,4-5H2,1H3 |
| InChIKey | WCCARMKANNFYRE-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|