C11H18O7S — CID 142708137
(5-hydroxy-2,5-dimethylhex-3-yn-2-yl)oxymethylsulfonyl ethaneperoxoate (PubChem CID 142708137) has the molecular formula C11H18O7S and a molecular weight of 294.32 g/mol. Its IUPAC name is (5-hydroxy-2,5-dimethylhex-3-yn-2-yl)oxymethylsulfonyl ethaneperoxoate.
| Compound Name | (5-hydroxy-2,5-dimethylhex-3-yn-2-yl)oxymethylsulfonyl ethaneperoxoate |
|---|---|
| PubChem CID | 142708137 |
| Molecular Formula | C11H18O7S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (5-hydroxy-2,5-dimethylhex-3-yn-2-yl)oxymethylsulfonyl ethaneperoxoate |
| SMILES | CC(=O)OOS(=O)(=O)COC(C)(C)C#CC(C)(C)O |
| InChI | InChI=1S/C11H18O7S/c1-9(12)17-18-19(14,15)8-16-11(4,5)7-6-10(2,3)13/h13H,8H2,1-5H3 |
| InChIKey | MYUFRHCCZWEJEZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|