About pentan-2-ylsulfonyl ethaneperoxoate
pentan-2-ylsulfonyl ethaneperoxoate (PubChem CID 154179834) has the molecular formula C7H14O5S
and a molecular weight of 210.25 g/mol. Its IUPAC name is pentan-2-ylsulfonyl ethaneperoxoate.
Molecular Properties
| Compound Name | pentan-2-ylsulfonyl ethaneperoxoate |
| PubChem CID | 154179834 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | pentan-2-ylsulfonyl ethaneperoxoate |
| SMILES | CCCC(C)S(=O)(=O)OOC(C)=O |
| InChI | InChI=1S/C7H14O5S/c1-4-5-6(2)13(9,10)12-11-7(3)8/h6H,4-5H2,1-3H3 |
| InChIKey | SVTQOJWEXQAZKJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-ylsulfonyl ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-ylsulfonyl ethaneperoxoate?
The IUPAC name of pentan-2-ylsulfonyl ethaneperoxoate (CID 154179834) is pentan-2-ylsulfonyl ethaneperoxoate.
What is the SMILES notation for pentan-2-ylsulfonyl ethaneperoxoate?
The canonical SMILES for pentan-2-ylsulfonyl ethaneperoxoate is CCCC(C)S(=O)(=O)OOC(C)=O.
What is the InChIKey of pentan-2-ylsulfonyl ethaneperoxoate?
The InChIKey is SVTQOJWEXQAZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O5S/c1-4-5-6(2)13(9,10)12-11-7(3)8/h6H,4-5H2,1-3H3.
What are the key properties of pentan-2-ylsulfonyl ethaneperoxoate?
pentan-2-ylsulfonyl ethaneperoxoate has a molecular weight of 210.25 g/mol, XLogP of 1.00, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-ylsulfonyl ethaneperoxoate is sourced from PubChem (CID 154179834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).