About pentan-2-ylsulfonyl prop-2-eneperoxoate
pentan-2-ylsulfonyl prop-2-eneperoxoate (PubChem CID 174467362) has the molecular formula C8H14O5S
and a molecular weight of 222.26 g/mol. Its IUPAC name is pentan-2-ylsulfonyl prop-2-eneperoxoate.
Molecular Properties
| Compound Name | pentan-2-ylsulfonyl prop-2-eneperoxoate |
| PubChem CID | 174467362 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | pentan-2-ylsulfonyl prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOS(=O)(=O)C(C)CCC |
| InChI | InChI=1S/C8H14O5S/c1-4-6-7(3)14(10,11)13-12-8(9)5-2/h5,7H,2,4,6H2,1,3H3 |
| InChIKey | OZVLPGXZFDMTJZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-ylsulfonyl prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-ylsulfonyl prop-2-eneperoxoate?
The IUPAC name of pentan-2-ylsulfonyl prop-2-eneperoxoate (CID 174467362) is pentan-2-ylsulfonyl prop-2-eneperoxoate.
What is the SMILES notation for pentan-2-ylsulfonyl prop-2-eneperoxoate?
The canonical SMILES for pentan-2-ylsulfonyl prop-2-eneperoxoate is C=CC(=O)OOS(=O)(=O)C(C)CCC.
What is the InChIKey of pentan-2-ylsulfonyl prop-2-eneperoxoate?
The InChIKey is OZVLPGXZFDMTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5S/c1-4-6-7(3)14(10,11)13-12-8(9)5-2/h5,7H,2,4,6H2,1,3H3.
What are the key properties of pentan-2-ylsulfonyl prop-2-eneperoxoate?
pentan-2-ylsulfonyl prop-2-eneperoxoate has a molecular weight of 222.26 g/mol, XLogP of 1.17, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-ylsulfonyl prop-2-eneperoxoate is sourced from PubChem (CID 174467362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).