About 2-(1-hydroxyethyl)pentyl prop-2-enoate
2-(1-hydroxyethyl)pentyl prop-2-enoate (PubChem CID 152751756) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)pentyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)pentyl prop-2-enoate |
| PubChem CID | 152751756 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-(1-hydroxyethyl)pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCC)C(C)O |
| InChI | InChI=1S/C10H18O3/c1-4-6-9(8(3)11)7-13-10(12)5-2/h5,8-9,11H,2,4,6-7H2,1,3H3 |
| InChIKey | UWWXQQZQKDFDNQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxyethyl)pentyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)pentyl prop-2-enoate?
The IUPAC name of 2-(1-hydroxyethyl)pentyl prop-2-enoate (CID 152751756) is 2-(1-hydroxyethyl)pentyl prop-2-enoate.
What is the SMILES notation for 2-(1-hydroxyethyl)pentyl prop-2-enoate?
The canonical SMILES for 2-(1-hydroxyethyl)pentyl prop-2-enoate is C=CC(=O)OCC(CCC)C(C)O.
What is the InChIKey of 2-(1-hydroxyethyl)pentyl prop-2-enoate?
The InChIKey is UWWXQQZQKDFDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-4-6-9(8(3)11)7-13-10(12)5-2/h5,8-9,11H,2,4,6-7H2,1,3H3.
What are the key properties of 2-(1-hydroxyethyl)pentyl prop-2-enoate?
2-(1-hydroxyethyl)pentyl prop-2-enoate has a molecular weight of 186.25 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)pentyl prop-2-enoate is sourced from PubChem (CID 152751756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).