C17H24O6 — CID 142730669
[4,5-dioxo-2-(2-oxobutanoyl)-3-propylheptyl] prop-2-enoate (PubChem CID 142730669) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [4,5-dioxo-2-(2-oxobutanoyl)-3-propylheptyl] prop-2-enoate.
| Compound Name | [4,5-dioxo-2-(2-oxobutanoyl)-3-propylheptyl] prop-2-enoate |
|---|---|
| PubChem CID | 142730669 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [4,5-dioxo-2-(2-oxobutanoyl)-3-propylheptyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C(=O)C(=O)CC)C(CCC)C(=O)C(=O)CC |
| InChI | InChI=1S/C17H24O6/c1-5-9-11(16(21)13(18)6-2)12(10-23-15(20)8-4)17(22)14(19)7-3/h8,11-12H,4-7,9-10H2,1-3H3 |
| InChIKey | UFLULBXNYGWXDV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|