About ethyl prop-2-eneperoxoate
ethyl prop-2-eneperoxoate (PubChem CID 18352416) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is ethyl prop-2-eneperoxoate.
Molecular Properties
| Compound Name | ethyl prop-2-eneperoxoate |
| PubChem CID | 18352416 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | ethyl prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOCC |
| InChI | InChI=1S/C5H8O3/c1-3-5(6)8-7-4-2/h3H,1,4H2,2H3 |
| InChIKey | RBVLUTAXWVILBT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-eneperoxoate?
The IUPAC name of ethyl prop-2-eneperoxoate (CID 18352416) is ethyl prop-2-eneperoxoate.
What is the SMILES notation for ethyl prop-2-eneperoxoate?
The canonical SMILES for ethyl prop-2-eneperoxoate is C=CC(=O)OOCC.
What is the InChIKey of ethyl prop-2-eneperoxoate?
The InChIKey is RBVLUTAXWVILBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3/c1-3-5(6)8-7-4-2/h3H,1,4H2,2H3.
What are the key properties of ethyl prop-2-eneperoxoate?
ethyl prop-2-eneperoxoate has a molecular weight of 116.12 g/mol, XLogP of 0.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-eneperoxoate is sourced from PubChem (CID 18352416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).