About ethyl 2-oxoethaneperoxoate
ethyl 2-oxoethaneperoxoate (PubChem CID 18324539) has the molecular formula C4H6O4
and a molecular weight of 118.09 g/mol. Its IUPAC name is ethyl 2-oxoethaneperoxoate.
Molecular Properties
| Compound Name | ethyl 2-oxoethaneperoxoate |
| PubChem CID | 18324539 |
| Molecular Formula | C4H6O4 |
| Molecular Weight | 118.09 g/mol |
| Exact Mass | 118.03 |
| IUPAC Name | ethyl 2-oxoethaneperoxoate |
| SMILES | CCOOC(=O)C=O |
| InChI | InChI=1S/C4H6O4/c1-2-7-8-4(6)3-5/h3H,2H2,1H3 |
| InChIKey | KWUHJWSNEZYQPL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.09 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-oxoethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxoethaneperoxoate?
The IUPAC name of ethyl 2-oxoethaneperoxoate (CID 18324539) is ethyl 2-oxoethaneperoxoate.
What is the SMILES notation for ethyl 2-oxoethaneperoxoate?
The canonical SMILES for ethyl 2-oxoethaneperoxoate is CCOOC(=O)C=O.
What is the InChIKey of ethyl 2-oxoethaneperoxoate?
The InChIKey is KWUHJWSNEZYQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4/c1-2-7-8-4(6)3-5/h3H,2H2,1H3.
What are the key properties of ethyl 2-oxoethaneperoxoate?
ethyl 2-oxoethaneperoxoate has a molecular weight of 118.09 g/mol, XLogP of -0.32, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxoethaneperoxoate is sourced from PubChem (CID 18324539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).