C15H28O8 — CID 159398856
2,2-dimethylpropane-1,3-diol;bis(ethyl prop-2-eneperoxoate) (PubChem CID 159398856) has the molecular formula C15H28O8 and a molecular weight of 336.38 g/mol. Its IUPAC name is 2,2-dimethylpropane-1,3-diol;bis(ethyl prop-2-eneperoxoate).
| Compound Name | 2,2-dimethylpropane-1,3-diol;bis(ethyl prop-2-eneperoxoate) |
|---|---|
| PubChem CID | 159398856 |
| Molecular Formula | C15H28O8 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2,2-dimethylpropane-1,3-diol;bis(ethyl prop-2-eneperoxoate) |
| SMILES | C=CC(=O)OOCC.C=CC(=O)OOCC.CC(C)(CO)CO |
| InChI | InChI=1S/2C5H8O3.C5H12O2/c2*1-3-5(6)8-7-4-2;1-5(2,3-6)4-7/h2*3H,1,4H2,2H3;6-7H,3-4H2,1-2H3 |
| InChIKey | LNBSKWVLUJUCLA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|