About ethyl butaneperoxoate;zirconium
ethyl butaneperoxoate;zirconium (PubChem CID 159069953) has the molecular formula C12H24O6Zr
and a molecular weight of 355.54 g/mol. Its IUPAC name is ethyl butaneperoxoate;zirconium.
Molecular Properties
| Compound Name | ethyl butaneperoxoate;zirconium |
| PubChem CID | 159069953 |
| Molecular Formula | C12H24O6Zr |
| Molecular Weight | 355.54 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | ethyl butaneperoxoate;zirconium |
| SMILES | CCCC(=O)OOCC.CCCC(=O)OOCC.[Zr] |
| InChI | InChI=1S/2C6H12O3.Zr/c2*1-3-5-6(7)9-8-4-2;/h2*3-5H2,1-2H3; |
| InChIKey | JZNDBEVZRJAAJO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl butaneperoxoate;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl butaneperoxoate;zirconium?
The IUPAC name of ethyl butaneperoxoate;zirconium (CID 159069953) is ethyl butaneperoxoate;zirconium.
What is the SMILES notation for ethyl butaneperoxoate;zirconium?
The canonical SMILES for ethyl butaneperoxoate;zirconium is CCCC(=O)OOCC.CCCC(=O)OOCC.[Zr].
What is the InChIKey of ethyl butaneperoxoate;zirconium?
The InChIKey is JZNDBEVZRJAAJO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12O3.Zr/c2*1-3-5-6(7)9-8-4-2;/h2*3-5H2,1-2H3;.
What are the key properties of ethyl butaneperoxoate;zirconium?
ethyl butaneperoxoate;zirconium has a molecular weight of 355.54 g/mol, XLogP of 2.56, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl butaneperoxoate;zirconium is sourced from PubChem (CID 159069953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).