About ethyl 2-iminoethaneperoxoate
ethyl 2-iminoethaneperoxoate (PubChem CID 174251053) has the molecular formula C4H7NO3
and a molecular weight of 117.10 g/mol. Its IUPAC name is ethyl 2-iminoethaneperoxoate.
Molecular Properties
| Compound Name | ethyl 2-iminoethaneperoxoate |
| PubChem CID | 174251053 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | ethyl 2-iminoethaneperoxoate |
| SMILES | [H]/N=C/C(=O)OOCC |
| InChI | InChI=1S/C4H7NO3/c1-2-7-8-4(6)3-5/h3,5H,2H2,1H3/b5-3+ |
| InChIKey | YNTBOLHOVSEAJG-HWKANZROSA-N |
| XLogP | 0.13 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-iminoethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-iminoethaneperoxoate?
The IUPAC name of ethyl 2-iminoethaneperoxoate (CID 174251053) is ethyl 2-iminoethaneperoxoate.
What is the SMILES notation for ethyl 2-iminoethaneperoxoate?
The canonical SMILES for ethyl 2-iminoethaneperoxoate is [H]/N=C/C(=O)OOCC.
What is the InChIKey of ethyl 2-iminoethaneperoxoate?
The InChIKey is YNTBOLHOVSEAJG-HWKANZROSA-N. The full InChI is InChI=1S/C4H7NO3/c1-2-7-8-4(6)3-5/h3,5H,2H2,1H3/b5-3+.
What are the key properties of ethyl 2-iminoethaneperoxoate?
ethyl 2-iminoethaneperoxoate has a molecular weight of 117.10 g/mol, XLogP of 0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-iminoethaneperoxoate is sourced from PubChem (CID 174251053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).