C10H12O3 — CID 14054792
(8S)-1,8-dihydroxydeca-4,6-diyn-3-one (PubChem CID 14054792) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (8S)-1,8-dihydroxydeca-4,6-diyn-3-one.
| Compound Name | (8S)-1,8-dihydroxydeca-4,6-diyn-3-one |
|---|---|
| PubChem CID | 14054792 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (8S)-1,8-dihydroxydeca-4,6-diyn-3-one |
| SMILES | CC[C@H](O)C#CC#CC(=O)CCO |
| InChI | InChI=1S/C10H12O3/c1-2-9(12)5-3-4-6-10(13)7-8-11/h9,11-12H,2,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | QZASPBLUOUWUAA-VIFPVBQESA-N |
| XLogP | -0.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|