C17H20O — CID 53474332
(3S)-7-(4-tert-butylphenyl)hepta-4,6-diyn-3-ol (PubChem CID 53474332) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (3S)-7-(4-tert-butylphenyl)hepta-4,6-diyn-3-ol.
| Compound Name | (3S)-7-(4-tert-butylphenyl)hepta-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 53474332 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (3S)-7-(4-tert-butylphenyl)hepta-4,6-diyn-3-ol |
| SMILES | CC[C@H](O)C#CC#Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H20O/c1-5-16(18)9-7-6-8-14-10-12-15(13-11-14)17(2,3)4/h10-13,16,18H,5H2,1-4H3/t16-/m0/s1 |
| InChIKey | SJDJVRNFXYJUOE-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|