C4H11NO3 — CID 174342165
(1S,2S)-2-amino-1-methoxypropane-1,3-diol (PubChem CID 174342165) has the molecular formula C4H11NO3 and a molecular weight of 121.14 g/mol. Its IUPAC name is (1S,2S)-2-amino-1-methoxypropane-1,3-diol.
| Compound Name | (1S,2S)-2-amino-1-methoxypropane-1,3-diol |
|---|---|
| PubChem CID | 174342165 |
| Molecular Formula | C4H11NO3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (1S,2S)-2-amino-1-methoxypropane-1,3-diol |
| SMILES | CO[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C4H11NO3/c1-8-4(7)3(5)2-6/h3-4,6-7H,2,5H2,1H3/t3-,4-/m0/s1 |
| InChIKey | PZYYMIMRISBZAN-IMJSIDKUSA-N |
| XLogP | -1.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|