C5H13NO3 — CID 143333753
3-amino-1-methoxybutane-1,4-diol (PubChem CID 143333753) has the molecular formula C5H13NO3 and a molecular weight of 135.16 g/mol. Its IUPAC name is 3-amino-1-methoxybutane-1,4-diol.
| Compound Name | 3-amino-1-methoxybutane-1,4-diol |
|---|---|
| PubChem CID | 143333753 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3-amino-1-methoxybutane-1,4-diol |
| SMILES | COC(O)CC(N)CO |
| InChI | InChI=1S/C5H13NO3/c1-9-5(8)2-4(6)3-7/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | KZFGQUVOEQHXNT-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|