C4H9F2NO — CID 95378166
(2R)-2-amino-4,4-difluorobutan-1-ol (PubChem CID 95378166) has the molecular formula C4H9F2NO and a molecular weight of 125.12 g/mol. Its IUPAC name is (2R)-2-amino-4,4-difluorobutan-1-ol.
| Compound Name | (2R)-2-amino-4,4-difluorobutan-1-ol |
|---|---|
| PubChem CID | 95378166 |
| Molecular Formula | C4H9F2NO |
| Molecular Weight | 125.12 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | (2R)-2-amino-4,4-difluorobutan-1-ol |
| SMILES | N[C@@H](CO)CC(F)F |
| InChI | InChI=1S/C4H9F2NO/c5-4(6)1-3(7)2-8/h3-4,8H,1-2,7H2/t3-/m1/s1 |
| InChIKey | OYELFFAJRCUOTI-GSVOUGTGSA-N |
| XLogP | -0.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.12 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |