C6H13ClO3 — CID 97050424
(1S,3R)-4-chloro-1,3-dimethoxybutan-1-ol (PubChem CID 97050424) has the molecular formula C6H13ClO3 and a molecular weight of 168.62 g/mol. Its IUPAC name is (1S,3R)-4-chloro-1,3-dimethoxybutan-1-ol.
| Compound Name | (1S,3R)-4-chloro-1,3-dimethoxybutan-1-ol |
|---|---|
| PubChem CID | 97050424 |
| Molecular Formula | C6H13ClO3 |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (1S,3R)-4-chloro-1,3-dimethoxybutan-1-ol |
| SMILES | CO[C@@H](CCl)C[C@@H](O)OC |
| InChI | InChI=1S/C6H13ClO3/c1-9-5(4-7)3-6(8)10-2/h5-6,8H,3-4H2,1-2H3/t5-,6+/m1/s1 |
| InChIKey | CNGUFKQUDIAWQU-RITPCOANSA-N |
| XLogP | 0.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|