About 1-methoxypropan-1-ol;silane
1-methoxypropan-1-ol;silane (PubChem CID 174772111) has the molecular formula C4H14O2Si
and a molecular weight of 122.24 g/mol. Its IUPAC name is 1-methoxypropan-1-ol;silane.
Molecular Properties
| Compound Name | 1-methoxypropan-1-ol;silane |
| PubChem CID | 174772111 |
| Molecular Formula | C4H14O2Si |
| Molecular Weight | 122.24 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 1-methoxypropan-1-ol;silane |
| SMILES | CCC(O)OC.[SiH4] |
| InChI | InChI=1S/C4H10O2.H4Si/c1-3-4(5)6-2;/h4-5H,3H2,1-2H3;1H4 |
| InChIKey | GSKZLOZBQMHNNC-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropan-1-ol;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-1-ol;silane?
The IUPAC name of 1-methoxypropan-1-ol;silane (CID 174772111) is 1-methoxypropan-1-ol;silane.
What is the SMILES notation for 1-methoxypropan-1-ol;silane?
The canonical SMILES for 1-methoxypropan-1-ol;silane is CCC(O)OC.[SiH4].
What is the InChIKey of 1-methoxypropan-1-ol;silane?
The InChIKey is GSKZLOZBQMHNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.H4Si/c1-3-4(5)6-2;/h4-5H,3H2,1-2H3;1H4.
What are the key properties of 1-methoxypropan-1-ol;silane?
1-methoxypropan-1-ol;silane has a molecular weight of 122.24 g/mol, XLogP of -1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-1-ol;silane is sourced from PubChem (CID 174772111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).