C6H14O3 — CID 130624159
(2S,3S)-2,3-dimethoxybutan-1-ol (PubChem CID 130624159) has the molecular formula C6H14O3 and a molecular weight of 134.18 g/mol. Its IUPAC name is (2S,3S)-2,3-dimethoxybutan-1-ol.
| Compound Name | (2S,3S)-2,3-dimethoxybutan-1-ol |
|---|---|
| PubChem CID | 130624159 |
| Molecular Formula | C6H14O3 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.09 |
| IUPAC Name | (2S,3S)-2,3-dimethoxybutan-1-ol |
| SMILES | CO[C@@H](C)[C@H](CO)OC |
| InChI | InChI=1S/C6H14O3/c1-5(8-2)6(4-7)9-3/h5-7H,4H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | JFCIOMTUSXLLMJ-WDSKDSINSA-N |
| XLogP | 0.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |