C9H20O4 — CID 10559649
(2R,3R,5S)-3,5-dimethoxy-2-methylhexane-1,6-diol (PubChem CID 10559649) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is (2R,3R,5S)-3,5-dimethoxy-2-methylhexane-1,6-diol.
| Compound Name | (2R,3R,5S)-3,5-dimethoxy-2-methylhexane-1,6-diol |
|---|---|
| PubChem CID | 10559649 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | (2R,3R,5S)-3,5-dimethoxy-2-methylhexane-1,6-diol |
| SMILES | CO[C@H](CO)C[C@@H](OC)[C@H](C)CO |
| InChI | InChI=1S/C9H20O4/c1-7(5-10)9(13-3)4-8(6-11)12-2/h7-11H,4-6H2,1-3H3/t7-,8+,9-/m1/s1 |
| InChIKey | YJGSROWRYUMCDG-HRDYMLBCSA-N |
| XLogP | 0.03 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |