About ethane;2-methoxybutan-1-ol
ethane;2-methoxybutan-1-ol (PubChem CID 174440725) has the molecular formula C7H18O2
and a molecular weight of 134.22 g/mol. Its IUPAC name is ethane;2-methoxybutan-1-ol.
Molecular Properties
| Compound Name | ethane;2-methoxybutan-1-ol |
| PubChem CID | 174440725 |
| Molecular Formula | C7H18O2 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.13 |
| IUPAC Name | ethane;2-methoxybutan-1-ol |
| SMILES | CC.CCC(CO)OC |
| InChI | InChI=1S/C5H12O2.C2H6/c1-3-5(4-6)7-2;1-2/h5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | ZLPLSUNMSPFLFZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methoxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxybutan-1-ol?
The IUPAC name of ethane;2-methoxybutan-1-ol (CID 174440725) is ethane;2-methoxybutan-1-ol.
What is the SMILES notation for ethane;2-methoxybutan-1-ol?
The canonical SMILES for ethane;2-methoxybutan-1-ol is CC.CCC(CO)OC.
What is the InChIKey of ethane;2-methoxybutan-1-ol?
The InChIKey is ZLPLSUNMSPFLFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2.C2H6/c1-3-5(4-6)7-2;1-2/h5-6H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methoxybutan-1-ol?
ethane;2-methoxybutan-1-ol has a molecular weight of 134.22 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxybutan-1-ol is sourced from PubChem (CID 174440725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).