C15H32O6 — CID 134878459
(2S,3S,4R,5R,6R,7S,8S)-9-methoxy-2,4,6,8-tetramethyldecane-1,3,5,7,10-pentol (PubChem CID 134878459) has the molecular formula C15H32O6 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R,7S,8S)-9-methoxy-2,4,6,8-tetramethyldecane-1,3,5,7,10-pentol.
| Compound Name | (2S,3S,4R,5R,6R,7S,8S)-9-methoxy-2,4,6,8-tetramethyldecane-1,3,5,7,10-pentol |
|---|---|
| PubChem CID | 134878459 |
| Molecular Formula | C15H32O6 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | (2S,3S,4R,5R,6R,7S,8S)-9-methoxy-2,4,6,8-tetramethyldecane-1,3,5,7,10-pentol |
| SMILES | COC(CO)[C@@H](C)[C@@H](O)[C@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C15H32O6/c1-8(6-16)13(18)10(3)15(20)11(4)14(19)9(2)12(7-17)21-5/h8-20H,6-7H2,1-5H3/t8-,9+,10+,11-,12?,13-,14+,15+/m0/s1 |
| InChIKey | GHUTURNYHGKJCN-CNHVMFJUSA-N |
| XLogP | -0.39 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |