C7H16IN — CID 174324402
(2S,3S)-6-iodo-3-methylhexan-2-amine (PubChem CID 174324402) has the molecular formula C7H16IN and a molecular weight of 241.12 g/mol. Its IUPAC name is (2S,3S)-6-iodo-3-methylhexan-2-amine.
| Compound Name | (2S,3S)-6-iodo-3-methylhexan-2-amine |
|---|---|
| PubChem CID | 174324402 |
| Molecular Formula | C7H16IN |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | (2S,3S)-6-iodo-3-methylhexan-2-amine |
| SMILES | C[C@H](N)[C@@H](C)CCCI |
| InChI | InChI=1S/C7H16IN/c1-6(7(2)9)4-3-5-8/h6-7H,3-5,9H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | MLNGIKCVRDCMMB-BQBZGAKWSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|