C5H12N2 — CID 143973690
(E)-pent-1-ene-1,4-diamine (PubChem CID 143973690) has the molecular formula C5H12N2 and a molecular weight of 100.16 g/mol. Its IUPAC name is (E)-pent-1-ene-1,4-diamine.
| Compound Name | (E)-pent-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 143973690 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | (E)-pent-1-ene-1,4-diamine |
| SMILES | CC(N)C/C=C/N |
| InChI | InChI=1S/C5H12N2/c1-5(7)3-2-4-6/h2,4-5H,3,6-7H2,1H3/b4-2+ |
| InChIKey | RIVJANFVPDPICH-DUXPYHPUSA-N |
| XLogP | 0.20 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |