C13H27N — CID 163641387
(E)-4,6-diethylnon-1-en-1-amine (PubChem CID 163641387) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is (E)-4,6-diethylnon-1-en-1-amine.
| Compound Name | (E)-4,6-diethylnon-1-en-1-amine |
|---|---|
| PubChem CID | 163641387 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | (E)-4,6-diethylnon-1-en-1-amine |
| SMILES | CCCC(CC)CC(CC)C/C=C/N |
| InChI | InChI=1S/C13H27N/c1-4-8-12(5-2)11-13(6-3)9-7-10-14/h7,10,12-13H,4-6,8-9,11,14H2,1-3H3/b10-7+ |
| InChIKey | IEOANBHPWRSSNG-JXMROGBWSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |