About 2,4-diethylheptyl formate
2,4-diethylheptyl formate (PubChem CID 54536990) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 2,4-diethylheptyl formate.
Molecular Properties
| Compound Name | 2,4-diethylheptyl formate |
| PubChem CID | 54536990 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 2,4-diethylheptyl formate |
| SMILES | CCCC(CC)CC(CC)COC=O |
| InChI | InChI=1S/C12H24O2/c1-4-7-11(5-2)8-12(6-3)9-14-10-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | CYQRLDWTYFVXIN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethylheptyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethylheptyl formate?
The IUPAC name of 2,4-diethylheptyl formate (CID 54536990) is 2,4-diethylheptyl formate.
What is the SMILES notation for 2,4-diethylheptyl formate?
The canonical SMILES for 2,4-diethylheptyl formate is CCCC(CC)CC(CC)COC=O.
What is the InChIKey of 2,4-diethylheptyl formate?
The InChIKey is CYQRLDWTYFVXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-4-7-11(5-2)8-12(6-3)9-14-10-13/h10-12H,4-9H2,1-3H3.
What are the key properties of 2,4-diethylheptyl formate?
2,4-diethylheptyl formate has a molecular weight of 200.32 g/mol, XLogP of 3.40, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethylheptyl formate is sourced from PubChem (CID 54536990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).