About 2-methyldecyl formate
2-methyldecyl formate (PubChem CID 174806813) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-methyldecyl formate.
Molecular Properties
| Compound Name | 2-methyldecyl formate |
| PubChem CID | 174806813 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | 2-methyldecyl formate |
| SMILES | CCCCCCCCC(C)COC=O |
| InChI | InChI=1S/C12H24O2/c1-3-4-5-6-7-8-9-12(2)10-14-11-13/h11-12H,3-10H2,1-2H3 |
| InChIKey | VCAVCFHULPPVGD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldecyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldecyl formate?
The IUPAC name of 2-methyldecyl formate (CID 174806813) is 2-methyldecyl formate.
What is the SMILES notation for 2-methyldecyl formate?
The canonical SMILES for 2-methyldecyl formate is CCCCCCCCC(C)COC=O.
What is the InChIKey of 2-methyldecyl formate?
The InChIKey is VCAVCFHULPPVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2/c1-3-4-5-6-7-8-9-12(2)10-14-11-13/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-methyldecyl formate?
2-methyldecyl formate has a molecular weight of 200.32 g/mol, XLogP of 3.55, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldecyl formate is sourced from PubChem (CID 174806813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).