C47H97NO5 — CID 176691345
4-(dioctylamino)butan-1-ol;2-hexyldecyl formate;2-methyloctyl formate (PubChem CID 176691345) has the molecular formula C47H97NO5 and a molecular weight of 756.29 g/mol. Its IUPAC name is 4-(dioctylamino)butan-1-ol;2-hexyldecyl formate;2-methyloctyl formate.
| Compound Name | 4-(dioctylamino)butan-1-ol;2-hexyldecyl formate;2-methyloctyl formate |
|---|---|
| PubChem CID | 176691345 |
| Molecular Formula | C47H97NO5 |
| Molecular Weight | 756.29 g/mol |
| Exact Mass | 755.74 |
| IUPAC Name | 4-(dioctylamino)butan-1-ol;2-hexyldecyl formate;2-methyloctyl formate |
| SMILES | CCCCCCC(C)COC=O.CCCCCCCCC(CCCCCC)COC=O.CCCCCCCCN(CCCCO)CCCCCCCC |
| InChI | InChI=1S/C20H43NO.C17H34O2.C10H20O2/c1-3-5-7-9-11-13-17-21(19-15-16-20-22)18-14-12-10-8-6-4-2;1-3-5-7-9-10-12-14-17(15-19-16-18)13-11-8-6-4-2;1-3-4-5-6-7-10(2)8-12-9-11/h22H,3-20H2,1-2H3;16-17H,3-15H2,1-2H3;9-10H,3-8H2,1-2H3 |
| InChIKey | UZYNMMZNFWRYTB-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.29 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|