About 2-ethylpentyl formate
2-ethylpentyl formate (PubChem CID 19982810) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2-ethylpentyl formate.
Molecular Properties
| Compound Name | 2-ethylpentyl formate |
| PubChem CID | 19982810 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2-ethylpentyl formate |
| SMILES | CCCC(CC)COC=O |
| InChI | InChI=1S/C8H16O2/c1-3-5-8(4-2)6-10-7-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | YIRKWHCYYATTBB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylpentyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentyl formate?
The IUPAC name of 2-ethylpentyl formate (CID 19982810) is 2-ethylpentyl formate.
What is the SMILES notation for 2-ethylpentyl formate?
The canonical SMILES for 2-ethylpentyl formate is CCCC(CC)COC=O.
What is the InChIKey of 2-ethylpentyl formate?
The InChIKey is YIRKWHCYYATTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-5-8(4-2)6-10-7-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-ethylpentyl formate?
2-ethylpentyl formate has a molecular weight of 144.21 g/mol, XLogP of 1.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentyl formate is sourced from PubChem (CID 19982810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).