About CID 174093884
CID 174093884 (PubChem CID 174093884) has the molecular formula C8H18BNO
and a molecular weight of 155.05 g/mol.
Molecular Properties
| Compound Name | CID 174093884 |
| PubChem CID | 174093884 |
| Molecular Formula | C8H18BNO |
| Molecular Weight | 155.05 g/mol |
| Exact Mass | 155.15 |
| IUPAC Name | — |
| SMILES | [B]N(C)OCC(CC)CCC |
| InChI | InChI=1S/C8H18BNO/c1-4-6-8(5-2)7-11-10(3)9/h8H,4-7H2,1-3H3 |
| InChIKey | GIPDMDPLZRWWID-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.05 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 174093884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174093884?
The IUPAC name of CID 174093884 (CID 174093884) is not available.
What is the SMILES notation for CID 174093884?
The canonical SMILES for CID 174093884 is [B]N(C)OCC(CC)CCC.
What is the InChIKey of CID 174093884?
The InChIKey is GIPDMDPLZRWWID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18BNO/c1-4-6-8(5-2)7-11-10(3)9/h8H,4-7H2,1-3H3.
What are the key properties of CID 174093884?
CID 174093884 has a molecular weight of 155.05 g/mol, XLogP of 1.76, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174093884 is sourced from PubChem (CID 174093884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).