C12H29NO2Si — CID 151837014
2-(2-ethylhexoxysilyloxy)-N,N-dimethylethanamine (PubChem CID 151837014) has the molecular formula C12H29NO2Si and a molecular weight of 247.45 g/mol. Its IUPAC name is 2-(2-ethylhexoxysilyloxy)-N,N-dimethylethanamine.
| Compound Name | 2-(2-ethylhexoxysilyloxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 151837014 |
| Molecular Formula | C12H29NO2Si |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 2-(2-ethylhexoxysilyloxy)-N,N-dimethylethanamine |
| SMILES | CCCCC(CC)CO[SiH2]OCCN(C)C |
| InChI | InChI=1S/C12H29NO2Si/c1-5-7-8-12(6-2)11-15-16-14-10-9-13(3)4/h12H,5-11,16H2,1-4H3 |
| InChIKey | SFWFQRHAYQAEQL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|