About 4,4-dihydroxybutylazanium bromide
4,4-dihydroxybutylazanium bromide (PubChem CID 139637636) has the molecular formula C4H12BrNO2
and a molecular weight of 186.05 g/mol. Its IUPAC name is 4,4-dihydroxybutylazanium bromide.
Molecular Properties
| Compound Name | 4,4-dihydroxybutylazanium bromide |
| PubChem CID | 139637636 |
| Molecular Formula | C4H12BrNO2 |
| Molecular Weight | 186.05 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 4,4-dihydroxybutylazanium bromide |
| SMILES | [Br-].[NH3+]CCCC(O)O |
| InChI | InChI=1S/C4H11NO2.BrH/c5-3-1-2-4(6)7;/h4,6-7H,1-3,5H2;1H |
| InChIKey | FAIAYQZHPWIYBU-UHFFFAOYSA-N |
| XLogP | -4.68 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.05 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dihydroxybutylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dihydroxybutylazanium bromide?
The IUPAC name of 4,4-dihydroxybutylazanium bromide (CID 139637636) is 4,4-dihydroxybutylazanium bromide.
What is the SMILES notation for 4,4-dihydroxybutylazanium bromide?
The canonical SMILES for 4,4-dihydroxybutylazanium bromide is [Br-].[NH3+]CCCC(O)O.
What is the InChIKey of 4,4-dihydroxybutylazanium bromide?
The InChIKey is FAIAYQZHPWIYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.BrH/c5-3-1-2-4(6)7;/h4,6-7H,1-3,5H2;1H.
What are the key properties of 4,4-dihydroxybutylazanium bromide?
4,4-dihydroxybutylazanium bromide has a molecular weight of 186.05 g/mol, XLogP of -4.68, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dihydroxybutylazanium bromide is sourced from PubChem (CID 139637636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).