C23H37N — CID 138745104
(2Z,5Z,8Z,11Z,14Z,17Z)-21-methyldocosa-2,5,8,11,14,17-hexaen-1-amine (PubChem CID 138745104) has the molecular formula C23H37N and a molecular weight of 327.56 g/mol. Its IUPAC name is (2Z,5Z,8Z,11Z,14Z,17Z)-21-methyldocosa-2,5,8,11,14,17-hexaen-1-amine.
| Compound Name | (2Z,5Z,8Z,11Z,14Z,17Z)-21-methyldocosa-2,5,8,11,14,17-hexaen-1-amine |
|---|---|
| PubChem CID | 138745104 |
| Molecular Formula | C23H37N |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | (2Z,5Z,8Z,11Z,14Z,17Z)-21-methyldocosa-2,5,8,11,14,17-hexaen-1-amine |
| SMILES | CC(C)CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CN |
| InChI | InChI=1S/C23H37N/c1-23(2)21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24/h3,5-6,8-9,11-12,14-15,17-18,20,23H,4,7,10,13,16,19,21-22,24H2,1-2H3/b5-3-,8-6-,11-9-,14-12-,17-15-,20-18- |
| InChIKey | GMIKRDOGFYBLQO-FDOFLUAYSA-N |
| XLogP | 6.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|