About 5-methylhex-2-en-1-amine;hydrochloride
5-methylhex-2-en-1-amine;hydrochloride (PubChem CID 173399515) has the molecular formula C7H16ClN
and a molecular weight of 149.66 g/mol. Its IUPAC name is 5-methylhex-2-en-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-methylhex-2-en-1-amine;hydrochloride |
| PubChem CID | 173399515 |
| Molecular Formula | C7H16ClN |
| Molecular Weight | 149.66 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 5-methylhex-2-en-1-amine;hydrochloride |
| SMILES | CC(C)CC=CCN.Cl |
| InChI | InChI=1S/C7H15N.ClH/c1-7(2)5-3-4-6-8;/h3-4,7H,5-6,8H2,1-2H3;1H |
| InChIKey | VMIPASNHEICLNG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhex-2-en-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-2-en-1-amine;hydrochloride?
The IUPAC name of 5-methylhex-2-en-1-amine;hydrochloride (CID 173399515) is 5-methylhex-2-en-1-amine;hydrochloride.
What is the SMILES notation for 5-methylhex-2-en-1-amine;hydrochloride?
The canonical SMILES for 5-methylhex-2-en-1-amine;hydrochloride is CC(C)CC=CCN.Cl.
What is the InChIKey of 5-methylhex-2-en-1-amine;hydrochloride?
The InChIKey is VMIPASNHEICLNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.ClH/c1-7(2)5-3-4-6-8;/h3-4,7H,5-6,8H2,1-2H3;1H.
What are the key properties of 5-methylhex-2-en-1-amine;hydrochloride?
5-methylhex-2-en-1-amine;hydrochloride has a molecular weight of 149.66 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-2-en-1-amine;hydrochloride is sourced from PubChem (CID 173399515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).