About 6-methylhept-2-enamide
6-methylhept-2-enamide (PubChem CID 130247366) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 6-methylhept-2-enamide.
Molecular Properties
| Compound Name | 6-methylhept-2-enamide |
| PubChem CID | 130247366 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 6-methylhept-2-enamide |
| SMILES | CC(C)CCC=CC(N)=O |
| InChI | InChI=1S/C8H15NO/c1-7(2)5-3-4-6-8(9)10/h4,6-7H,3,5H2,1-2H3,(H2,9,10) |
| InChIKey | JMEMTUHDWFSITR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-2-enamide?
The IUPAC name of 6-methylhept-2-enamide (CID 130247366) is 6-methylhept-2-enamide.
What is the SMILES notation for 6-methylhept-2-enamide?
The canonical SMILES for 6-methylhept-2-enamide is CC(C)CCC=CC(N)=O.
What is the InChIKey of 6-methylhept-2-enamide?
The InChIKey is JMEMTUHDWFSITR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-7(2)5-3-4-6-8(9)10/h4,6-7H,3,5H2,1-2H3,(H2,9,10).
What are the key properties of 6-methylhept-2-enamide?
6-methylhept-2-enamide has a molecular weight of 141.21 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-2-enamide is sourced from PubChem (CID 130247366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).