C22H50 — CID 143342118
ethane;4-ethyl-2,9,12-trimethyltridecane (PubChem CID 143342118) has the molecular formula C22H50 and a molecular weight of 314.64 g/mol. Its IUPAC name is ethane;4-ethyl-2,9,12-trimethyltridecane.
| Compound Name | ethane;4-ethyl-2,9,12-trimethyltridecane |
|---|---|
| PubChem CID | 143342118 |
| Molecular Formula | C22H50 |
| Molecular Weight | 314.64 g/mol |
| Exact Mass | 314.39 |
| IUPAC Name | ethane;4-ethyl-2,9,12-trimethyltridecane |
| SMILES | CC.CC.CCC(CCCCC(C)CCC(C)C)CC(C)C |
| InChI | InChI=1S/C18H38.2C2H6/c1-7-18(14-16(4)5)11-9-8-10-17(6)13-12-15(2)3;2*1-2/h15-18H,7-14H2,1-6H3;2*1-2H3 |
| InChIKey | SQNNKLWOHLNNBK-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.64 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|