C48H100 — CID 160563987
6-ethyl-2,8-dimethylicosane;2,6,9-trimethylhenicosane (PubChem CID 160563987) has the molecular formula C48H100 and a molecular weight of 677.33 g/mol. Its IUPAC name is 6-ethyl-2,8-dimethylicosane;2,6,9-trimethylhenicosane.
| Compound Name | 6-ethyl-2,8-dimethylicosane;2,6,9-trimethylhenicosane |
|---|---|
| PubChem CID | 160563987 |
| Molecular Formula | C48H100 |
| Molecular Weight | 677.33 g/mol |
| Exact Mass | 676.78 |
| IUPAC Name | 6-ethyl-2,8-dimethylicosane;2,6,9-trimethylhenicosane |
| SMILES | CCCCCCCCCCCCC(C)CC(CC)CCCC(C)C.CCCCCCCCCCCCC(C)CCC(C)CCCC(C)C |
| InChI | InChI=1S/2C24H50/c1-6-7-8-9-10-11-12-13-14-15-18-23(4)20-21-24(5)19-16-17-22(2)3;1-6-8-9-10-11-12-13-14-15-16-19-23(5)21-24(7-2)20-17-18-22(3)4/h2*22-24H,6-21H2,1-5H3 |
| InChIKey | QZRKZTPYDBDNSV-UHFFFAOYSA-N |
| XLogP | 18.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.33 |
| LogP ≤ 5 | 18.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|