C22H46 — CID 159635838
14-ethyl-2,6,7,10-tetramethylhexadecane (PubChem CID 159635838) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is 14-ethyl-2,6,7,10-tetramethylhexadecane.
| Compound Name | 14-ethyl-2,6,7,10-tetramethylhexadecane |
|---|---|
| PubChem CID | 159635838 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 14-ethyl-2,6,7,10-tetramethylhexadecane |
| SMILES | CCC(CC)CCCC(C)CCC(C)C(C)CCCC(C)C |
| InChI | InChI=1S/C22H46/c1-8-22(9-2)15-11-13-19(5)16-17-21(7)20(6)14-10-12-18(3)4/h18-22H,8-17H2,1-7H3 |
| InChIKey | PYKLBSIJGQTASK-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |