C12H22N2 — CID 139215266
2,5-di(butan-2-yl)-2,5-dihydropyrazine (PubChem CID 139215266) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 2,5-di(butan-2-yl)-2,5-dihydropyrazine.
| Compound Name | 2,5-di(butan-2-yl)-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 139215266 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 2,5-di(butan-2-yl)-2,5-dihydropyrazine |
| SMILES | CCC(C)C1C=NC(C(C)CC)C=N1 |
| InChI | InChI=1S/C12H22N2/c1-5-9(3)11-7-14-12(8-13-11)10(4)6-2/h7-12H,5-6H2,1-4H3 |
| InChIKey | CWXZINNYIDOOSZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |