About 4-butan-2-yltriazetidine
4-butan-2-yltriazetidine (PubChem CID 130056510) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is 4-butan-2-yltriazetidine.
Molecular Properties
| Compound Name | 4-butan-2-yltriazetidine |
| PubChem CID | 130056510 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 4-butan-2-yltriazetidine |
| SMILES | CCC(C)C1NNN1 |
| InChI | InChI=1S/C5H13N3/c1-3-4(2)5-6-8-7-5/h4-8H,3H2,1-2H3 |
| InChIKey | JPKLYDHKOKOLDM-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butan-2-yltriazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yltriazetidine?
The IUPAC name of 4-butan-2-yltriazetidine (CID 130056510) is 4-butan-2-yltriazetidine.
What is the SMILES notation for 4-butan-2-yltriazetidine?
The canonical SMILES for 4-butan-2-yltriazetidine is CCC(C)C1NNN1.
What is the InChIKey of 4-butan-2-yltriazetidine?
The InChIKey is JPKLYDHKOKOLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3/c1-3-4(2)5-6-8-7-5/h4-8H,3H2,1-2H3.
What are the key properties of 4-butan-2-yltriazetidine?
4-butan-2-yltriazetidine has a molecular weight of 115.18 g/mol, XLogP of -0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yltriazetidine is sourced from PubChem (CID 130056510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).