C11H20N2O4 — CID 71434541
3-butan-2-yl-1,4-dihydroxy-6-propan-2-ylpiperazine-2,5-dione (PubChem CID 71434541) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-butan-2-yl-1,4-dihydroxy-6-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-1,4-dihydroxy-6-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 71434541 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 3-butan-2-yl-1,4-dihydroxy-6-propan-2-ylpiperazine-2,5-dione |
| SMILES | CCC(C)C1C(=O)N(O)C(C(C)C)C(=O)N1O |
| InChI | InChI=1S/C11H20N2O4/c1-5-7(4)9-11(15)12(16)8(6(2)3)10(14)13(9)17/h6-9,16-17H,5H2,1-4H3 |
| InChIKey | HDDPDGAEWFESMF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|