C30H51N3O9 — CID 101346562
(3S,6R,9S,12R,15S,18R)-3,9,15-tris[(2S)-butan-2-yl]-4,6,10,12,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 101346562) has the molecular formula C30H51N3O9 and a molecular weight of 597.75 g/mol. Its IUPAC name is (3S,6R,9S,12R,15S,18R)-3,9,15-tris[(2S)-butan-2-yl]-4,6,10,12,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6R,9S,12R,15S,18R)-3,9,15-tris[(2S)-butan-2-yl]-4,6,10,12,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 101346562 |
| Molecular Formula | C30H51N3O9 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.36 |
| IUPAC Name | (3S,6R,9S,12R,15S,18R)-3,9,15-tris[(2S)-butan-2-yl]-4,6,10,12,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC[C@H](C)[C@H]1C(=O)O[C@H](C)C(=O)N(C)[C@@H]([C@@H](C)CC)C(=O)O[C@H](C)C(=O)N(C)[C@@H]([C@@H](C)CC)C(=O)O[C@H](C)C(=O)N1C |
| InChI | InChI=1S/C30H51N3O9/c1-13-16(4)22-28(37)40-20(8)26(35)32(11)24(18(6)15-3)30(39)42-21(9)27(36)33(12)23(17(5)14-2)29(38)41-19(7)25(34)31(22)10/h16-24H,13-15H2,1-12H3/t16-,17-,18-,19+,20+,21+,22-,23-,24-/m0/s1 |
| InChIKey | ZZQUTSJAJOEJOG-MOIHWDIPSA-N |
| XLogP | 2.41 |
| TPSA | 139.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|