C33H57N3O9 — CID 71598216
(3S,6R,9S,12R,15S,18R)-18-[(2S)-butan-2-yl]-4,10-dimethyl-3,6,9,12,15-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 71598216) has the molecular formula C33H57N3O9 and a molecular weight of 639.83 g/mol. Its IUPAC name is (3S,6R,9S,12R,15S,18R)-18-[(2S)-butan-2-yl]-4,10-dimethyl-3,6,9,12,15-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | (3S,6R,9S,12R,15S,18R)-18-[(2S)-butan-2-yl]-4,10-dimethyl-3,6,9,12,15-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 71598216 |
| Molecular Formula | C33H57N3O9 |
| Molecular Weight | 639.83 g/mol |
| Exact Mass | 639.41 |
| IUPAC Name | (3S,6R,9S,12R,15S,18R)-18-[(2S)-butan-2-yl]-4,10-dimethyl-3,6,9,12,15-penta(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CC[C@H](C)[C@H]1OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)N(C)C(=O)[C@@H](C(C)C)OC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C33H57N3O9/c1-15-21(12)27-28(37)34-22(16(2)3)31(40)43-25(19(8)9)29(38)35(13)23(17(4)5)32(41)44-26(20(10)11)30(39)36(14)24(18(6)7)33(42)45-27/h16-27H,15H2,1-14H3,(H,34,37)/t21-,22-,23-,24-,25+,26+,27+/m0/s1 |
| InChIKey | NWZZFEUJPJYWNF-AGJHWSBGSA-N |
| XLogP | 3.20 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|