C36H63N3O10 — CID 72759787
6,12-di(butan-2-yl)-18-(2-hydroxybutan-2-yl)-4,10,16-trimethyl-3,9,15-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone (PubChem CID 72759787) has the molecular formula C36H63N3O10 and a molecular weight of 697.91 g/mol. Its IUPAC name is 6,12-di(butan-2-yl)-18-(2-hydroxybutan-2-yl)-4,10,16-trimethyl-3,9,15-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone.
| Compound Name | 6,12-di(butan-2-yl)-18-(2-hydroxybutan-2-yl)-4,10,16-trimethyl-3,9,15-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
|---|---|
| PubChem CID | 72759787 |
| Molecular Formula | C36H63N3O10 |
| Molecular Weight | 697.91 g/mol |
| Exact Mass | 697.45 |
| IUPAC Name | 6,12-di(butan-2-yl)-18-(2-hydroxybutan-2-yl)-4,10,16-trimethyl-3,9,15-tri(propan-2-yl)-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone |
| SMILES | CCC(C)C1OC(=O)C(C(C)C)N(C)C(=O)C(C(C)CC)OC(=O)C(C(C)C)N(C)C(=O)C(C(C)(O)CC)OC(=O)C(C(C)C)N(C)C1=O |
| InChI | InChI=1S/C36H63N3O10/c1-16-22(10)27-30(40)37(13)24(19(4)5)33(43)47-28(23(11)17-2)31(41)38(14)26(21(8)9)35(45)49-29(36(12,46)18-3)32(42)39(15)25(20(6)7)34(44)48-27/h19-29,46H,16-18H2,1-15H3 |
| InChIKey | OEJHQIOIRDFEIC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 160.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|