C21H40P2 — CID 102049504
ditert-butyl-(3-ditert-butylphosphanylcyclopenta-1,4-dien-1-yl)phosphane (PubChem CID 102049504) has the molecular formula C21H40P2 and a molecular weight of 354.50 g/mol. Its IUPAC name is ditert-butyl-(3-ditert-butylphosphanylcyclopenta-1,4-dien-1-yl)phosphane.
| Compound Name | ditert-butyl-(3-ditert-butylphosphanylcyclopenta-1,4-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 102049504 |
| Molecular Formula | C21H40P2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | ditert-butyl-(3-ditert-butylphosphanylcyclopenta-1,4-dien-1-yl)phosphane |
| SMILES | CC(C)(C)P(C1=CC(P(C(C)(C)C)C(C)(C)C)C=C1)C(C)(C)C |
| InChI | InChI=1S/C21H40P2/c1-18(2,3)22(19(4,5)6)16-13-14-17(15-16)23(20(7,8)9)21(10,11)12/h13-16H,1-12H3 |
| InChIKey | SXTIYMIFWTUSCW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|